C16H22ClN3O — CID 56658087
N-[[2-(2-chlorophenyl)-1,3-oxazol-4-yl]methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 56658087) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is N-[[2-(2-chlorophenyl)-1,3-oxazol-4-yl]methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[[2-(2-chlorophenyl)-1,3-oxazol-4-yl]methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 56658087 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-[[2-(2-chlorophenyl)-1,3-oxazol-4-yl]methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1coc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C16H22ClN3O/c1-3-20(4-2)10-9-18-11-13-12-21-16(19-13)14-7-5-6-8-15(14)17/h5-8,12,18H,3-4,9-11H2,1-2H3 |
| InChIKey | SLGYAUJOYGDBMQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|