C21H22N4O2 — CID 56658174
3-[3-[2-(3-methoxyphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 56658174) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[3-[2-(3-methoxyphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[3-[2-(3-methoxyphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 56658174 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[3-[2-(3-methoxyphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | COc1cccc(C#Cc2nc3ncccc3nc2OCCCN(C)C)c1 |
| InChI | InChI=1S/C21H22N4O2/c1-25(2)13-6-14-27-21-19(23-20-18(24-21)9-5-12-22-20)11-10-16-7-4-8-17(15-16)26-3/h4-5,7-9,12,15H,6,13-14H2,1-3H3 |
| InChIKey | QOSQRJOFYLWCJR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|