C25H31ClO6S — CID 56658255
(1S,16R,17S,18R,19R)-5-chloro-4-[(4-methylsulfanylphenyl)methyl]-8,14,20-trioxatricyclo[14.3.1.02,7]icosa-2(7),3,5-triene-17,18,19-triol (PubChem CID 56658255) has the molecular formula C25H31ClO6S and a molecular weight of 495.04 g/mol. Its IUPAC name is (1S,16R,17S,18R,19R)-5-chloro-4-[(4-methylsulfanylphenyl)methyl]-8,14,20-trioxatricyclo[14.3.1.02,7]icosa-2(7),3,5-triene-17,18,19-triol.
| Compound Name | (1S,16R,17S,18R,19R)-5-chloro-4-[(4-methylsulfanylphenyl)methyl]-8,14,20-trioxatricyclo[14.3.1.02,7]icosa-2(7),3,5-triene-17,18,19-triol |
|---|---|
| PubChem CID | 56658255 |
| Molecular Formula | C25H31ClO6S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (1S,16R,17S,18R,19R)-5-chloro-4-[(4-methylsulfanylphenyl)methyl]-8,14,20-trioxatricyclo[14.3.1.02,7]icosa-2(7),3,5-triene-17,18,19-triol |
| SMILES | CSc1ccc(Cc2cc3c(cc2Cl)OCCCCCOC[C@H]2O[C@@H]3[C@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C25H31ClO6S/c1-33-17-7-5-15(6-8-17)11-16-12-18-20(13-19(16)26)31-10-4-2-3-9-30-14-21-22(27)23(28)24(29)25(18)32-21/h5-8,12-13,21-25,27-29H,2-4,9-11,14H2,1H3/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | JLLGTIOLQFBCGJ-RXFVIIJJSA-N |
| XLogP | 3.75 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |