C18H18N4O2S — CID 56658309
6,7-dimethoxy-3-pyridin-4-yl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide (PubChem CID 56658309) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 6,7-dimethoxy-3-pyridin-4-yl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide.
| Compound Name | 6,7-dimethoxy-3-pyridin-4-yl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 56658309 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 6,7-dimethoxy-3-pyridin-4-yl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)C1=NN(C(N)=S)C(c3ccncc3)C1C2 |
| InChI | InChI=1S/C18H18N4O2S/c1-23-14-8-11-7-13-16(12(11)9-15(14)24-2)21-22(18(19)25)17(13)10-3-5-20-6-4-10/h3-6,8-9,13,17H,7H2,1-2H3,(H2,19,25) |
| InChIKey | BUJZAYWHDVQZSM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|