About 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole
4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole (PubChem CID 56658332) has the molecular formula C23H25N3O4
and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole |
| PubChem CID | 56658332 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole |
| SMILES | COc1cccc(-c2nc(CN3CCN(Cc4ccc5c(c4)OCO5)CC3)co2)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-27-20-4-2-3-18(12-20)23-24-19(15-28-23)14-26-9-7-25(8-10-26)13-17-5-6-21-22(11-17)30-16-29-21/h2-6,11-12,15H,7-10,13-14,16H2,1H3 |
| InChIKey | PMGZYAZVEIZEKS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole?
The IUPAC name of 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole (CID 56658332) is 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole.
What is the SMILES notation for 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole?
The canonical SMILES for 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole is COc1cccc(-c2nc(CN3CCN(Cc4ccc5c(c4)OCO5)CC3)co2)c1.
What is the InChIKey of 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole?
The InChIKey is PMGZYAZVEIZEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O4/c1-27-20-4-2-3-18(12-20)23-24-19(15-28-23)14-26-9-7-25(8-10-26)13-17-5-6-21-22(11-17)30-16-29-21/h2-6,11-12,15H,7-10,13-14,16H2,1H3.
What are the key properties of 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole?
4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole has a molecular weight of 407.47 g/mol, XLogP of 3.40, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-2-(3-methoxyphenyl)-1,3-oxazole is sourced from PubChem (CID 56658332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).