About 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid
3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid (PubChem CID 56658430) has the molecular formula C18H12F5N3O3
and a molecular weight of 413.30 g/mol. Its IUPAC name is 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid |
| PubChem CID | 56658430 |
| Molecular Formula | C18H12F5N3O3 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid |
| SMILES | NC(=O)Nc1c(C(=O)O)n(Cc2cc(F)ccc2F)c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C18H12F5N3O3/c19-10-2-3-12(20)8(5-10)7-26-13-4-1-9(18(21,22)23)6-11(13)14(25-17(24)29)15(26)16(27)28/h1-6H,7H2,(H,27,28)(H3,24,25,29) |
| InChIKey | GVARIWZSFJWCIK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid?
The IUPAC name of 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid (CID 56658430) is 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid.
What is the SMILES notation for 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid?
The canonical SMILES for 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid is NC(=O)Nc1c(C(=O)O)n(Cc2cc(F)ccc2F)c2ccc(C(F)(F)F)cc12.
What is the InChIKey of 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid?
The InChIKey is GVARIWZSFJWCIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F5N3O3/c19-10-2-3-12(20)8(5-10)7-26-13-4-1-9(18(21,22)23)6-11(13)14(25-17(24)29)15(26)16(27)28/h1-6H,7H2,(H,27,28)(H3,24,25,29).
What are the key properties of 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid?
3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid has a molecular weight of 413.30 g/mol, XLogP of 4.18, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(carbamoylamino)-1-[(2,5-difluorophenyl)methyl]-5-(trifluoromethyl)indole-2-carboxylic acid is sourced from PubChem (CID 56658430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).