About tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate
tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate (PubChem CID 56658512) has the molecular formula C21H26F2N4O2
and a molecular weight of 404.46 g/mol. Its IUPAC name is tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate |
| PubChem CID | 56658512 |
| Molecular Formula | C21H26F2N4O2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(c2cnccn2)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C21H26F2N4O2/c1-21(2,3)29-20(28)27-10-6-15(7-11-27)26-19(18-13-24-8-9-25-18)16-5-4-14(22)12-17(16)23/h4-5,8-9,12-13,15,19,26H,6-7,10-11H2,1-3H3 |
| InChIKey | ULEQEOZRFMIWNW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate (CID 56658512) is tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(NC(c2cnccn2)c2ccc(F)cc2F)CC1.
What is the InChIKey of tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate?
The InChIKey is ULEQEOZRFMIWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26F2N4O2/c1-21(2,3)29-20(28)27-10-6-15(7-11-27)26-19(18-13-24-8-9-25-18)16-5-4-14(22)12-17(16)23/h4-5,8-9,12-13,15,19,26H,6-7,10-11H2,1-3H3.
What are the key properties of tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate?
tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate has a molecular weight of 404.46 g/mol, XLogP of 3.83, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidine-1-carboxylate is sourced from PubChem (CID 56658512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).