About 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone
1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone (PubChem CID 56658650) has the molecular formula C24H24F2N4O
and a molecular weight of 422.48 g/mol. Its IUPAC name is 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone.
Molecular Properties
| Compound Name | 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone |
| PubChem CID | 56658650 |
| Molecular Formula | C24H24F2N4O |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCC(NC(c2cnccn2)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C24H24F2N4O/c25-18-6-7-20(21(26)15-18)24(22-16-27-10-11-28-22)29-19-8-12-30(13-9-19)23(31)14-17-4-2-1-3-5-17/h1-7,10-11,15-16,19,24,29H,8-9,12-14H2 |
| InChIKey | FMLVPBKDWXMDJI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone?
The IUPAC name of 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone (CID 56658650) is 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone.
What is the SMILES notation for 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone?
The canonical SMILES for 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone is O=C(Cc1ccccc1)N1CCC(NC(c2cnccn2)c2ccc(F)cc2F)CC1.
What is the InChIKey of 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone?
The InChIKey is FMLVPBKDWXMDJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24F2N4O/c25-18-6-7-20(21(26)15-18)24(22-16-27-10-11-28-22)29-19-8-12-30(13-9-19)23(31)14-17-4-2-1-3-5-17/h1-7,10-11,15-16,19,24,29H,8-9,12-14H2.
What are the key properties of 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone?
1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone has a molecular weight of 422.48 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[(2,4-difluorophenyl)-pyrazin-2-ylmethyl]amino]piperidin-1-yl]-2-phenylethanone is sourced from PubChem (CID 56658650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).