About N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine
N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine (PubChem CID 56658876) has the molecular formula C16H14FN3O
and a molecular weight of 283.31 g/mol. Its IUPAC name is N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine.
Molecular Properties
| Compound Name | N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine |
| PubChem CID | 56658876 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine |
| SMILES | Fc1ccccc1-c1nc(CNCc2ccncc2)co1 |
| InChI | InChI=1S/C16H14FN3O/c17-15-4-2-1-3-14(15)16-20-13(11-21-16)10-19-9-12-5-7-18-8-6-12/h1-8,11,19H,9-10H2 |
| InChIKey | AWLQTSGOPLXUQA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine?
The IUPAC name of N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine (CID 56658876) is N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine.
What is the SMILES notation for N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine?
The canonical SMILES for N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine is Fc1ccccc1-c1nc(CNCc2ccncc2)co1.
What is the InChIKey of N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine?
The InChIKey is AWLQTSGOPLXUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FN3O/c17-15-4-2-1-3-14(15)16-20-13(11-21-16)10-19-9-12-5-7-18-8-6-12/h1-8,11,19H,9-10H2.
What are the key properties of N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine?
N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine has a molecular weight of 283.31 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-1-pyridin-4-ylmethanamine is sourced from PubChem (CID 56658876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).