C25H29N3O5 — CID 56659085
(E)-but-2-enedioic acid;4-[(2-methyl-5-phenyl-1,5-dihydro-2,4-benzodiazepin-3-yl)methyl]morpholine (PubChem CID 56659085) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-[(2-methyl-5-phenyl-1,5-dihydro-2,4-benzodiazepin-3-yl)methyl]morpholine.
| Compound Name | (E)-but-2-enedioic acid;4-[(2-methyl-5-phenyl-1,5-dihydro-2,4-benzodiazepin-3-yl)methyl]morpholine |
|---|---|
| PubChem CID | 56659085 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (E)-but-2-enedioic acid;4-[(2-methyl-5-phenyl-1,5-dihydro-2,4-benzodiazepin-3-yl)methyl]morpholine |
| SMILES | CN1Cc2ccccc2C(c2ccccc2)N=C1CN1CCOCC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H25N3O.C4H4O4/c1-23-15-18-9-5-6-10-19(18)21(17-7-3-2-4-8-17)22-20(23)16-24-11-13-25-14-12-24;5-3(6)1-2-4(7)8/h2-10,21H,11-16H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IOSBATYSNBJIDF-WLHGVMLRSA-N |
| XLogP | 2.66 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|