C25H31N3O2 — CID 56659208
N-(1,3-benzodioxol-5-ylmethyl)-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine (PubChem CID 56659208) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 56659208 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(7-pentan-3-ylquinolin-4-yl)propane-1,3-diamine |
| SMILES | CCC(CC)c1ccc2c(NCCCNCc3ccc4c(c3)OCO4)ccnc2c1 |
| InChI | InChI=1S/C25H31N3O2/c1-3-19(4-2)20-7-8-21-22(10-13-28-23(21)15-20)27-12-5-11-26-16-18-6-9-24-25(14-18)30-17-29-24/h6-10,13-15,19,26H,3-5,11-12,16-17H2,1-2H3,(H,27,28) |
| InChIKey | NJFDSNTXFVCVAB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|