C17H16BrN3O3 — CID 56659237
5-(6-bromo-3-pyridinyl)-3-(2,4-dimethylanilino)-5-methyl-1,3-oxazolidine-2,4-dione (PubChem CID 56659237) has the molecular formula C17H16BrN3O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is 5-(6-bromo-3-pyridinyl)-3-(2,4-dimethylanilino)-5-methyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-(6-bromo-3-pyridinyl)-3-(2,4-dimethylanilino)-5-methyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 56659237 |
| Molecular Formula | C17H16BrN3O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 5-(6-bromo-3-pyridinyl)-3-(2,4-dimethylanilino)-5-methyl-1,3-oxazolidine-2,4-dione |
| SMILES | Cc1ccc(NN2C(=O)OC(C)(c3ccc(Br)nc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C17H16BrN3O3/c1-10-4-6-13(11(2)8-10)20-21-15(22)17(3,24-16(21)23)12-5-7-14(18)19-9-12/h4-9,20H,1-3H3 |
| InChIKey | RJQKGYCVTBDKCK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|