About N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide
N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide (PubChem CID 56659291) has the molecular formula C24H23F2N3O2
and a molecular weight of 423.46 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide.
Molecular Properties
| Compound Name | N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide |
| PubChem CID | 56659291 |
| Molecular Formula | C24H23F2N3O2 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide |
| SMILES | CCC(C)N(CC(=O)Nc1cc(F)cc(F)c1)C(=O)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C24H23F2N3O2/c1-3-16(2)29(15-23(30)28-21-13-19(25)12-20(26)14-21)24(31)18-9-7-17(8-10-18)22-6-4-5-11-27-22/h4-14,16H,3,15H2,1-2H3,(H,28,30) |
| InChIKey | KQJPQVAOMPTZKE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide?
The IUPAC name of N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide (CID 56659291) is N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide.
What is the SMILES notation for N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide?
The canonical SMILES for N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide is CCC(C)N(CC(=O)Nc1cc(F)cc(F)c1)C(=O)c1ccc(-c2ccccn2)cc1.
What is the InChIKey of N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide?
The InChIKey is KQJPQVAOMPTZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F2N3O2/c1-3-16(2)29(15-23(30)28-21-13-19(25)12-20(26)14-21)24(31)18-9-7-17(8-10-18)22-6-4-5-11-27-22/h4-14,16H,3,15H2,1-2H3,(H,28,30).
What are the key properties of N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide?
N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide has a molecular weight of 423.46 g/mol, XLogP of 4.91, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-N-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-pyridin-2-ylbenzamide is sourced from PubChem (CID 56659291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).