C10H14O5S — CID 56659315
(1R,2S)-1-(4-methylsulfonylphenyl)propane-1,2,3-triol (PubChem CID 56659315) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is (1R,2S)-1-(4-methylsulfonylphenyl)propane-1,2,3-triol.
| Compound Name | (1R,2S)-1-(4-methylsulfonylphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 56659315 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (1R,2S)-1-(4-methylsulfonylphenyl)propane-1,2,3-triol |
| SMILES | CS(=O)(=O)c1ccc([C@@H](O)[C@@H](O)CO)cc1 |
| InChI | InChI=1S/C10H14O5S/c1-16(14,15)8-4-2-7(3-5-8)10(13)9(12)6-11/h2-5,9-13H,6H2,1H3/t9-,10+/m0/s1 |
| InChIKey | HVXLXQOZGAPITO-VHSXEESVSA-N |
| XLogP | -0.52 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |