C13H20O5S — CID 56659316
1-methylsulfonyl-4-[(1R,2S)-1,2,3-trimethoxypropyl]benzene (PubChem CID 56659316) has the molecular formula C13H20O5S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-methylsulfonyl-4-[(1R,2S)-1,2,3-trimethoxypropyl]benzene.
| Compound Name | 1-methylsulfonyl-4-[(1R,2S)-1,2,3-trimethoxypropyl]benzene |
|---|---|
| PubChem CID | 56659316 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-methylsulfonyl-4-[(1R,2S)-1,2,3-trimethoxypropyl]benzene |
| SMILES | COC[C@H](OC)[C@H](OC)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H20O5S/c1-16-9-12(17-2)13(18-3)10-5-7-11(8-6-10)19(4,14)15/h5-8,12-13H,9H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | ZGMHNOZALIMZLI-QWHCGFSZSA-N |
| XLogP | 1.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |