C21H18N2O4 — CID 56659326
8-(4-methoxyanilino)-6-methyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione (PubChem CID 56659326) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 8-(4-methoxyanilino)-6-methyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione.
| Compound Name | 8-(4-methoxyanilino)-6-methyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
|---|---|
| PubChem CID | 56659326 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 8-(4-methoxyanilino)-6-methyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
| SMILES | COc1ccc(NC2=CC(=O)c3c(c(C)nc4c3C(=O)CCC4)C2=O)cc1 |
| InChI | InChI=1S/C21H18N2O4/c1-11-18-20(19-14(22-11)4-3-5-16(19)24)17(25)10-15(21(18)26)23-12-6-8-13(27-2)9-7-12/h6-10,23H,3-5H2,1-2H3 |
| InChIKey | CNTVNLJAMVXXRV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|