C20H16FN3O — CID 56659478
4-(3-fluorophenyl)-5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-12-one (PubChem CID 56659478) has the molecular formula C20H16FN3O and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-12-one.
| Compound Name | 4-(3-fluorophenyl)-5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-12-one |
|---|---|
| PubChem CID | 56659478 |
| Molecular Formula | C20H16FN3O |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-(3-fluorophenyl)-5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-12-one |
| SMILES | O=C1NCCc2[nH]c3c(c21)CCc1cnc(-c2cccc(F)c2)cc1-3 |
| InChI | InChI=1S/C20H16FN3O/c21-13-3-1-2-11(8-13)17-9-15-12(10-23-17)4-5-14-18-16(24-19(14)15)6-7-22-20(18)25/h1-3,8-10,24H,4-7H2,(H,22,25) |
| InChIKey | KPIOYVVFFGHOBR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |