C16H23N3O4 — CID 56659534
N-hydroxy-2-[(5'S)-5'-methyl-2',6'-dioxospiro[adamantane-2,3'-piperazine]-1'-yl]acetamide (PubChem CID 56659534) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-hydroxy-2-[(5'S)-5'-methyl-2',6'-dioxospiro[adamantane-2,3'-piperazine]-1'-yl]acetamide.
| Compound Name | N-hydroxy-2-[(5'S)-5'-methyl-2',6'-dioxospiro[adamantane-2,3'-piperazine]-1'-yl]acetamide |
|---|---|
| PubChem CID | 56659534 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-hydroxy-2-[(5'S)-5'-methyl-2',6'-dioxospiro[adamantane-2,3'-piperazine]-1'-yl]acetamide |
| SMILES | C[C@@H]1NC2(C(=O)N(CC(=O)NO)C1=O)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C16H23N3O4/c1-8-14(21)19(7-13(20)18-23)15(22)16(17-8)11-3-9-2-10(5-11)6-12(16)4-9/h8-12,17,23H,2-7H2,1H3,(H,18,20)/t8-,9?,10?,11?,12?,16?/m0/s1 |
| InChIKey | HHQOIKOPYCYVTL-RJWNGJPQSA-N |
| XLogP | 0.03 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|