C30H44N4O4 — CID 56659646
(2S)-2-[[(2S,3aR,8bR)-3-[(2S,3S)-2-amino-3-methylpentanoyl]-8b-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]propanoic acid (PubChem CID 56659646) has the molecular formula C30H44N4O4 and a molecular weight of 524.71 g/mol. Its IUPAC name is (2S)-2-[[(2S,3aR,8bR)-3-[(2S,3S)-2-amino-3-methylpentanoyl]-8b-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S,3aR,8bR)-3-[(2S,3S)-2-amino-3-methylpentanoyl]-8b-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 56659646 |
| Molecular Formula | C30H44N4O4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | (2S)-2-[[(2S,3aR,8bR)-3-[(2S,3S)-2-amino-3-methylpentanoyl]-8b-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]propanoic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N1[C@H]2Nc3ccccc3[C@@]2(C/C=C(\C)CCC=C(C)C)C[C@H]1C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C30H44N4O4/c1-7-20(5)25(31)27(36)34-24(26(35)32-21(6)28(37)38)17-30(16-15-19(4)12-10-11-18(2)3)22-13-8-9-14-23(22)33-29(30)34/h8-9,11,13-15,20-21,24-25,29,33H,7,10,12,16-17,31H2,1-6H3,(H,32,35)(H,37,38)/b19-15+/t20-,21-,24-,25-,29+,30+/m0/s1 |
| InChIKey | CDOUMCHSQCCPSI-ZOUKXFKGSA-N |
| XLogP | 4.32 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|