C22H22N2O7 — CID 56659785
(3S,3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-3'-(3-nitrophenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione (PubChem CID 56659785) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is (3S,3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-3'-(3-nitrophenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione.
| Compound Name | (3S,3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-3'-(3-nitrophenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione |
|---|---|
| PubChem CID | 56659785 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (3S,3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-3'-(3-nitrophenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](OC(=O)[C@]23CC(c2cccc([N+](=O)[O-])c2)=NO3)[C@]2(C)C(=O)C=C[C@@]12O |
| InChI | InChI=1S/C22H22N2O7/c1-12-6-7-15-18(20(2)17(25)8-9-22(12,20)27)30-19(26)21(15)11-16(23-31-21)13-4-3-5-14(10-13)24(28)29/h3-5,8-10,12,15,18,27H,6-7,11H2,1-2H3/t12-,15+,18+,20-,21-,22+/m0/s1 |
| InChIKey | YXJGWDJJOBHZFA-MTXLUMKWSA-N |
| XLogP | 2.31 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|