C21H30ClN3O4 — CID 56660023
3-[3-oxo-5-(4-piperidin-4-ylbutanoylamino)-1H-isoindol-2-yl]butanoic acid;hydrochloride (PubChem CID 56660023) has the molecular formula C21H30ClN3O4 and a molecular weight of 423.94 g/mol. Its IUPAC name is 3-[3-oxo-5-(4-piperidin-4-ylbutanoylamino)-1H-isoindol-2-yl]butanoic acid;hydrochloride.
| Compound Name | 3-[3-oxo-5-(4-piperidin-4-ylbutanoylamino)-1H-isoindol-2-yl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 56660023 |
| Molecular Formula | C21H30ClN3O4 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 3-[3-oxo-5-(4-piperidin-4-ylbutanoylamino)-1H-isoindol-2-yl]butanoic acid;hydrochloride |
| SMILES | CC(CC(=O)O)N1Cc2ccc(NC(=O)CCCC3CCNCC3)cc2C1=O.Cl |
| InChI | InChI=1S/C21H29N3O4.ClH/c1-14(11-20(26)27)24-13-16-5-6-17(12-18(16)21(24)28)23-19(25)4-2-3-15-7-9-22-10-8-15;/h5-6,12,14-15,22H,2-4,7-11,13H2,1H3,(H,23,25)(H,26,27);1H |
| InChIKey | MVAPRARLGZLDBX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |