C29H36N4O3 — CID 56660076
(3R,4S)-N-cyclopropyl-N-[[6-(3-methoxypropyl)quinolin-8-yl]methyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide (PubChem CID 56660076) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is (3R,4S)-N-cyclopropyl-N-[[6-(3-methoxypropyl)quinolin-8-yl]methyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-cyclopropyl-N-[[6-(3-methoxypropyl)quinolin-8-yl]methyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56660076 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (3R,4S)-N-cyclopropyl-N-[[6-(3-methoxypropyl)quinolin-8-yl]methyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide |
| SMILES | COCCCc1cc(CN(C(=O)[C@H]2CNCC[C@@H]2c2ccn(C)c(=O)c2)C2CC2)c2ncccc2c1 |
| InChI | InChI=1S/C29H36N4O3/c1-32-13-10-21(17-27(32)34)25-9-12-30-18-26(25)29(35)33(24-7-8-24)19-23-16-20(5-4-14-36-2)15-22-6-3-11-31-28(22)23/h3,6,10-11,13,15-17,24-26,30H,4-5,7-9,12,14,18-19H2,1-2H3/t25-,26+/m1/s1 |
| InChIKey | RUOVAJPKWFGNRT-FTJBHMTQSA-N |
| XLogP | 3.40 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|