C16H23NOS — CID 56661048
8-isothiocyanato-3,8-dimethyl-5-propan-2-yl-1,4a,5,6,7,8a-hexahydronaphthalen-2-one (PubChem CID 56661048) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 8-isothiocyanato-3,8-dimethyl-5-propan-2-yl-1,4a,5,6,7,8a-hexahydronaphthalen-2-one.
| Compound Name | 8-isothiocyanato-3,8-dimethyl-5-propan-2-yl-1,4a,5,6,7,8a-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 56661048 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 8-isothiocyanato-3,8-dimethyl-5-propan-2-yl-1,4a,5,6,7,8a-hexahydronaphthalen-2-one |
| SMILES | CC1=CC2C(C(C)C)CCC(C)(N=C=S)C2CC1=O |
| InChI | InChI=1S/C16H23NOS/c1-10(2)12-5-6-16(4,17-9-19)14-8-15(18)11(3)7-13(12)14/h7,10,12-14H,5-6,8H2,1-4H3 |
| InChIKey | ODUZQPVIXXXOEL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|