C33H50N4O9 — CID 56661179
(3S,6R,9S,12R,15S,18R)-6-[(3-aminophenyl)methyl]-3,9-bis[(2R)-butan-2-yl]-4,10,12,15,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 56661179) has the molecular formula C33H50N4O9 and a molecular weight of 646.78 g/mol. Its IUPAC name is (3S,6R,9S,12R,15S,18R)-6-[(3-aminophenyl)methyl]-3,9-bis[(2R)-butan-2-yl]-4,10,12,15,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | (3S,6R,9S,12R,15S,18R)-6-[(3-aminophenyl)methyl]-3,9-bis[(2R)-butan-2-yl]-4,10,12,15,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 56661179 |
| Molecular Formula | C33H50N4O9 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.36 |
| IUPAC Name | (3S,6R,9S,12R,15S,18R)-6-[(3-aminophenyl)methyl]-3,9-bis[(2R)-butan-2-yl]-4,10,12,15,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CC[C@@H](C)[C@H]1C(=O)O[C@H](Cc2cccc(N)c2)C(=O)N(C)[C@@H]([C@H](C)CC)C(=O)O[C@H](C)C(=O)N(C)[C@@H](C)C(=O)O[C@H](C)C(=O)N1C |
| InChI | InChI=1S/C33H50N4O9/c1-11-18(3)26-32(42)45-21(6)28(38)35(8)20(5)31(41)44-22(7)29(39)36(9)27(19(4)12-2)33(43)46-25(30(40)37(26)10)17-23-14-13-15-24(34)16-23/h13-16,18-22,25-27H,11-12,17,34H2,1-10H3/t18-,19-,20+,21-,22-,25-,26+,27+/m1/s1 |
| InChIKey | MVZFEBFPBMZLEX-LFRLWGIZSA-N |
| XLogP | 2.19 |
| TPSA | 165.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|