C21H30BrN3O2 — CID 56661611
(2S)-2-(4-methoxyphenyl)-1-octyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (PubChem CID 56661611) has the molecular formula C21H30BrN3O2 and a molecular weight of 436.39 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)-1-octyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
| Compound Name | (2S)-2-(4-methoxyphenyl)-1-octyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
|---|---|
| PubChem CID | 56661611 |
| Molecular Formula | C21H30BrN3O2 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)-1-octyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| SMILES | CCCCCCCCN1c2nccc[n+]2C[C@@]1(O)c1ccc(OC)cc1.[Br-] |
| InChI | InChI=1S/C21H30N3O2.BrH/c1-3-4-5-6-7-8-16-24-20-22-14-9-15-23(20)17-21(24,25)18-10-12-19(26-2)13-11-18;/h9-15,25H,3-8,16-17H2,1-2H3;1H/q+1;/p-1/t21-;/m1./s1 |
| InChIKey | SACIPYLKUXTVNF-ZMBIFBSDSA-M |
| XLogP | 0.41 |
| TPSA | 49.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|