C20H26BrN3O — CID 56661615
(2S)-1-cyclooctyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (PubChem CID 56661615) has the molecular formula C20H26BrN3O and a molecular weight of 404.35 g/mol. Its IUPAC name is (2S)-1-cyclooctyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
| Compound Name | (2S)-1-cyclooctyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
|---|---|
| PubChem CID | 56661615 |
| Molecular Formula | C20H26BrN3O |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (2S)-1-cyclooctyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| SMILES | O[C@@]1(c2ccccc2)C[n+]2cccnc2N1C1CCCCCCC1.[Br-] |
| InChI | InChI=1S/C20H26N3O.BrH/c24-20(17-10-5-4-6-11-17)16-22-15-9-14-21-19(22)23(20)18-12-7-2-1-3-8-13-18;/h4-6,9-11,14-15,18,24H,1-3,7-8,12-13,16H2;1H/q+1;/p-1/t20-;/m1./s1 |
| InChIKey | RFHPDMIEDZKPJE-VEIFNGETSA-M |
| XLogP | 0.15 |
| TPSA | 40.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|