C24H25BF3NO — CID 56661647
4-[bis(2,6-dimethylphenyl)boranyl-(2,2,2-trifluoroethyl)amino]phenol (PubChem CID 56661647) has the molecular formula C24H25BF3NO and a molecular weight of 411.28 g/mol. Its IUPAC name is 4-[bis(2,6-dimethylphenyl)boranyl-(2,2,2-trifluoroethyl)amino]phenol.
| Compound Name | 4-[bis(2,6-dimethylphenyl)boranyl-(2,2,2-trifluoroethyl)amino]phenol |
|---|---|
| PubChem CID | 56661647 |
| Molecular Formula | C24H25BF3NO |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 4-[bis(2,6-dimethylphenyl)boranyl-(2,2,2-trifluoroethyl)amino]phenol |
| SMILES | Cc1cccc(C)c1B(c1c(C)cccc1C)N(CC(F)(F)F)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H25BF3NO/c1-16-7-5-8-17(2)22(16)25(23-18(3)9-6-10-19(23)4)29(15-24(26,27)28)20-11-13-21(30)14-12-20/h5-14,30H,15H2,1-4H3 |
| InChIKey | UGCKEDUYGRKYAN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|