C19H29N3O — CID 56661714
N-[[2-(4-butylphenyl)-1,3-oxazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 56661714) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[[2-(4-butylphenyl)-1,3-oxazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[2-(4-butylphenyl)-1,3-oxazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 56661714 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-[[2-(4-butylphenyl)-1,3-oxazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCCCc1ccc(-c2nc(CNCCCN(C)C)co2)cc1 |
| InChI | InChI=1S/C19H29N3O/c1-4-5-7-16-8-10-17(11-9-16)19-21-18(15-23-19)14-20-12-6-13-22(2)3/h8-11,15,20H,4-7,12-14H2,1-3H3 |
| InChIKey | KKNZORXMFWXBGK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|