C23H31N3O5 — CID 56661818
4-[(5R,6S,9S,13S)-7-(2-methyl-3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid (PubChem CID 56661818) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-[(5R,6S,9S,13S)-7-(2-methyl-3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid.
| Compound Name | 4-[(5R,6S,9S,13S)-7-(2-methyl-3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
|---|---|
| PubChem CID | 56661818 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 4-[(5R,6S,9S,13S)-7-(2-methyl-3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
| SMILES | Cc1c(C(=O)N2C[C@@H]3CCCN4CCC[C@@H]([C@H]34)[C@@H]2CCCC(=O)O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H31N3O5/c1-15-17(7-2-9-19(15)26(30)31)23(29)25-14-16-6-4-12-24-13-5-8-18(22(16)24)20(25)10-3-11-21(27)28/h2,7,9,16,18,20,22H,3-6,8,10-14H2,1H3,(H,27,28)/t16-,18+,20-,22-/m0/s1 |
| InChIKey | NKGWCLAJFVGETB-UPSSIMKTSA-N |
| XLogP | 3.47 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|