C16H19NO3 — CID 56661850
methyl 2-(4-butylphenyl)-4-methyl-1,3-oxazole-5-carboxylate (PubChem CID 56661850) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl 2-(4-butylphenyl)-4-methyl-1,3-oxazole-5-carboxylate.
| Compound Name | methyl 2-(4-butylphenyl)-4-methyl-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 56661850 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | methyl 2-(4-butylphenyl)-4-methyl-1,3-oxazole-5-carboxylate |
| SMILES | CCCCc1ccc(-c2nc(C)c(C(=O)OC)o2)cc1 |
| InChI | InChI=1S/C16H19NO3/c1-4-5-6-12-7-9-13(10-8-12)15-17-11(2)14(20-15)16(18)19-3/h7-10H,4-6H2,1-3H3 |
| InChIKey | OBNPBIYLKJXUCZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |