C41H40N8O4 — CID 56661899
3-(1H-indol-3-yl)-1-[2-[3-[2-[3-(1H-indol-3-yl)-4-(1-methylpyrrol-2-yl)-2,5-dioxopyrrol-1-yl]ethylamino]propylamino]ethyl]-4-(1-methylpyrrol-2-yl)pyrrole-2,5-dione (PubChem CID 56661899) has the molecular formula C41H40N8O4 and a molecular weight of 708.82 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-1-[2-[3-[2-[3-(1H-indol-3-yl)-4-(1-methylpyrrol-2-yl)-2,5-dioxopyrrol-1-yl]ethylamino]propylamino]ethyl]-4-(1-methylpyrrol-2-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-1-[2-[3-[2-[3-(1H-indol-3-yl)-4-(1-methylpyrrol-2-yl)-2,5-dioxopyrrol-1-yl]ethylamino]propylamino]ethyl]-4-(1-methylpyrrol-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 56661899 |
| Molecular Formula | C41H40N8O4 |
| Molecular Weight | 708.82 g/mol |
| Exact Mass | 708.32 |
| IUPAC Name | 3-(1H-indol-3-yl)-1-[2-[3-[2-[3-(1H-indol-3-yl)-4-(1-methylpyrrol-2-yl)-2,5-dioxopyrrol-1-yl]ethylamino]propylamino]ethyl]-4-(1-methylpyrrol-2-yl)pyrrole-2,5-dione |
| SMILES | Cn1cccc1C1=C(c2c[nH]c3ccccc23)C(=O)N(CCNCCCNCCN2C(=O)C(c3c[nH]c4ccccc34)=C(c3cccn3C)C2=O)C1=O |
| InChI | InChI=1S/C41H40N8O4/c1-46-20-7-14-32(46)36-34(28-24-44-30-12-5-3-10-26(28)30)38(50)48(40(36)52)22-18-42-16-9-17-43-19-23-49-39(51)35(29-25-45-31-13-6-4-11-27(29)31)37(41(49)53)33-15-8-21-47(33)2/h3-8,10-15,20-21,24-25,42-45H,9,16-19,22-23H2,1-2H3 |
| InChIKey | RVNFOGOEVNJSOT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|