C19H22N4O2 — CID 56661905
6-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]-2-methylpyridazin-3-one (PubChem CID 56661905) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]-2-methylpyridazin-3-one.
| Compound Name | 6-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 56661905 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 6-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]-2-methylpyridazin-3-one |
| SMILES | Cn1nc(-c2ccc(C(=O)N3CCN4CCC[C@H]4C3)cc2)ccc1=O |
| InChI | InChI=1S/C19H22N4O2/c1-21-18(24)9-8-17(20-21)14-4-6-15(7-5-14)19(25)23-12-11-22-10-2-3-16(22)13-23/h4-9,16H,2-3,10-13H2,1H3/t16-/m0/s1 |
| InChIKey | UBWFZEDDYVEBOR-INIZCTEOSA-N |
| XLogP | 1.37 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |