C46H36N6O8 — CID 56661911
N-benzoyl-N-[2-(dibenzoylamino)-9-[(1S,3R,4R,7S)-1-(hydroxymethyl)-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide (PubChem CID 56661911) has the molecular formula C46H36N6O8 and a molecular weight of 800.83 g/mol. Its IUPAC name is N-benzoyl-N-[2-(dibenzoylamino)-9-[(1S,3R,4R,7S)-1-(hydroxymethyl)-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide.
| Compound Name | N-benzoyl-N-[2-(dibenzoylamino)-9-[(1S,3R,4R,7S)-1-(hydroxymethyl)-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 56661911 |
| Molecular Formula | C46H36N6O8 |
| Molecular Weight | 800.83 g/mol |
| Exact Mass | 800.26 |
| IUPAC Name | N-benzoyl-N-[2-(dibenzoylamino)-9-[(1S,3R,4R,7S)-1-(hydroxymethyl)-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide |
| SMILES | O=C(c1ccccc1)N(C(=O)c1ccccc1)c1nc(N(C(=O)c2ccccc2)C(=O)c2ccccc2)c2ncn([C@@H]3O[C@@]4(CO)CO[C@@H]3[C@@H]4OCc3ccccc3)c2n1 |
| InChI | InChI=1S/C46H36N6O8/c53-27-46-28-59-36(37(46)58-26-30-16-6-1-7-17-30)44(60-46)50-29-47-35-38(50)48-45(52(42(56)33-22-12-4-13-23-33)43(57)34-24-14-5-15-25-34)49-39(35)51(40(54)31-18-8-2-9-19-31)41(55)32-20-10-3-11-21-32/h1-25,29,36-37,44,53H,26-28H2/t36-,37+,44-,46+/m1/s1 |
| InChIKey | AVWPJJJVUOABID-NFRMGEJDSA-N |
| XLogP | 6.04 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.83 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|