C17H27N5 — CID 56661929
2-N,4-N-dipentylpyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 56661929) has the molecular formula C17H27N5 and a molecular weight of 301.44 g/mol. Its IUPAC name is 2-N,4-N-dipentylpyrido[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-dipentylpyrido[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 56661929 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 2-N,4-N-dipentylpyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(NCCCCC)c2cccnc2n1 |
| InChI | InChI=1S/C17H27N5/c1-3-5-7-11-18-15-14-10-9-13-19-16(14)22-17(21-15)20-12-8-6-4-2/h9-10,13H,3-8,11-12H2,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | RMOLQIBSPSVBOW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|