About N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine
N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine (PubChem CID 56662243) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine.
Molecular Properties
| Compound Name | N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine |
| PubChem CID | 56662243 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine |
| SMILES | COc1cccc(CCNCc2coc(-c3ccco3)n2)c1 |
| InChI | InChI=1S/C17H18N2O3/c1-20-15-5-2-4-13(10-15)7-8-18-11-14-12-22-17(19-14)16-6-3-9-21-16/h2-6,9-10,12,18H,7-8,11H2,1H3 |
| InChIKey | VPGKDGWERJVCTP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine?
The IUPAC name of N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine (CID 56662243) is N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine.
What is the SMILES notation for N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine?
The canonical SMILES for N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine is COc1cccc(CCNCc2coc(-c3ccco3)n2)c1.
What is the InChIKey of N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine?
The InChIKey is VPGKDGWERJVCTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-20-15-5-2-4-13(10-15)7-8-18-11-14-12-22-17(19-14)16-6-3-9-21-16/h2-6,9-10,12,18H,7-8,11H2,1H3.
What are the key properties of N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine?
N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine has a molecular weight of 298.34 g/mol, XLogP of 3.28, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine is sourced from PubChem (CID 56662243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).