About N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine
N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine (PubChem CID 56662489) has the molecular formula C19H19FN2O2
and a molecular weight of 326.37 g/mol. Its IUPAC name is N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine.
Molecular Properties
| Compound Name | N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine |
| PubChem CID | 56662489 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine |
| SMILES | COc1cccc(CCNCc2coc(-c3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C19H19FN2O2/c1-23-18-7-2-4-14(10-18)8-9-21-12-17-13-24-19(22-17)15-5-3-6-16(20)11-15/h2-7,10-11,13,21H,8-9,12H2,1H3 |
| InChIKey | ZCPQNGFGQPKGSN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine?
The IUPAC name of N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine (CID 56662489) is N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine.
What is the SMILES notation for N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine?
The canonical SMILES for N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine is COc1cccc(CCNCc2coc(-c3cccc(F)c3)n2)c1.
What is the InChIKey of N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine?
The InChIKey is ZCPQNGFGQPKGSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O2/c1-23-18-7-2-4-14(10-18)8-9-21-12-17-13-24-19(22-17)15-5-3-6-16(20)11-15/h2-7,10-11,13,21H,8-9,12H2,1H3.
What are the key properties of N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine?
N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine has a molecular weight of 326.37 g/mol, XLogP of 3.82, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-(3-methoxyphenyl)ethanamine is sourced from PubChem (CID 56662489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).