About N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine
N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine (PubChem CID 56662535) has the molecular formula C18H19N3O
and a molecular weight of 293.37 g/mol. Its IUPAC name is N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine.
Molecular Properties
| Compound Name | N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine |
| PubChem CID | 56662535 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine |
| SMILES | CN(CCc1ccccn1)Cc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H19N3O/c1-21(12-10-16-9-5-6-11-19-16)13-17-14-22-18(20-17)15-7-3-2-4-8-15/h2-9,11,14H,10,12-13H2,1H3 |
| InChIKey | UZODSQLAMAWVLY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine?
The IUPAC name of N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine (CID 56662535) is N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine.
What is the SMILES notation for N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine?
The canonical SMILES for N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine is CN(CCc1ccccn1)Cc1coc(-c2ccccc2)n1.
What is the InChIKey of N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine?
The InChIKey is UZODSQLAMAWVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O/c1-21(12-10-16-9-5-6-11-19-16)13-17-14-22-18(20-17)15-7-3-2-4-8-15/h2-9,11,14H,10,12-13H2,1H3.
What are the key properties of N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine?
N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine has a molecular weight of 293.37 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyridin-2-ylethanamine is sourced from PubChem (CID 56662535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).