C27H22FN3O4S2 — CID 56662776
N-[[3-fluoro-4-[2-(oxolane-2-carbonyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 56662776) has the molecular formula C27H22FN3O4S2 and a molecular weight of 535.62 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-(oxolane-2-carbonyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-(oxolane-2-carbonyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 56662776 |
| Molecular Formula | C27H22FN3O4S2 |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | N-[[3-fluoro-4-[2-(oxolane-2-carbonyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3cc(C(=O)C4CCCO4)sc23)c(F)c1 |
| InChI | InChI=1S/C27H22FN3O4S2/c28-18-14-17(30-27(36)31-24(32)13-16-5-2-1-3-6-16)8-9-20(18)35-22-10-11-29-19-15-23(37-26(19)22)25(33)21-7-4-12-34-21/h1-3,5-6,8-11,14-15,21H,4,7,12-13H2,(H2,30,31,32,36) |
| InChIKey | ILEJENBOQJGTMF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|