C25H36FNO — CID 56662960
(2E,4E,6E,8E)-1-(4-fluoropiperidin-1-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 56662960) has the molecular formula C25H36FNO and a molecular weight of 385.57 g/mol. Its IUPAC name is (2E,4E,6E,8E)-1-(4-fluoropiperidin-1-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6E,8E)-1-(4-fluoropiperidin-1-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 56662960 |
| Molecular Formula | C25H36FNO |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | (2E,4E,6E,8E)-1-(4-fluoropiperidin-1-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)N2CCC(F)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H36FNO/c1-19(11-12-23-21(3)10-7-15-25(23,4)5)8-6-9-20(2)18-24(28)27-16-13-22(26)14-17-27/h6,8-9,11-12,18,22H,7,10,13-17H2,1-5H3/b9-6+,12-11+,19-8+,20-18+ |
| InChIKey | PDNUOPFMFITYIH-SFZCRTJJSA-N |
| XLogP | 6.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|