C36H30F3N7O2 — CID 56663021
4-[4-[9-(2-aminopyrimidin-5-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 56663021) has the molecular formula C36H30F3N7O2 and a molecular weight of 649.68 g/mol. Its IUPAC name is 4-[4-[9-(2-aminopyrimidin-5-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-[4-[9-(2-aminopyrimidin-5-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 56663021 |
| Molecular Formula | C36H30F3N7O2 |
| Molecular Weight | 649.68 g/mol |
| Exact Mass | 649.24 |
| IUPAC Name | 4-[4-[9-(2-aminopyrimidin-5-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CN1CCC(NC(=O)c2ccc(-c3ccc(-n4c(=O)ccc5cnc6ccc(-c7cnc(N)nc7)cc6c54)cc3C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C36H30F3N7O2/c1-45-14-12-26(13-15-45)44-34(48)22-4-2-21(3-5-22)28-9-8-27(17-30(28)36(37,38)39)46-32(47)11-7-24-18-41-31-10-6-23(16-29(31)33(24)46)25-19-42-35(40)43-20-25/h2-11,16-20,26H,12-15H2,1H3,(H,44,48)(H2,40,42,43) |
| InChIKey | FXCWWJRLKBHALN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.68 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|