C37H48F2N2O2 — CID 56663124
(1R,2S,5S,10S,14R,15R,23R)-20-(3,5-difluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid (PubChem CID 56663124) has the molecular formula C37H48F2N2O2 and a molecular weight of 590.80 g/mol. Its IUPAC name is (1R,2S,5S,10S,14R,15R,23R)-20-(3,5-difluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid.
| Compound Name | (1R,2S,5S,10S,14R,15R,23R)-20-(3,5-difluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 56663124 |
| Molecular Formula | C37H48F2N2O2 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | (1R,2S,5S,10S,14R,15R,23R)-20-(3,5-difluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6cnn(-c7cc(F)cc(F)c7)c6C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C37H48F2N2O2/c1-32(2)12-14-37(31(42)43)15-13-35(6)26(27(37)20-32)8-9-29-34(5)19-22-21-40-41(25-17-23(38)16-24(39)18-25)30(22)33(3,4)28(34)10-11-36(29,35)7/h8,16-18,21,27-29H,9-15,19-20H2,1-7H3,(H,42,43)/t27-,28-,29+,34-,35+,36+,37-/m0/s1 |
| InChIKey | NRDRFWMFKVELNA-CZBYLUSZSA-N |
| XLogP | 9.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|