C18H13F3N2O4 — CID 56663154
2,2,2-trifluoroethyl 1-(3-methoxybenzoyl)indazole-3-carboxylate (PubChem CID 56663154) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 1-(3-methoxybenzoyl)indazole-3-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 1-(3-methoxybenzoyl)indazole-3-carboxylate |
|---|---|
| PubChem CID | 56663154 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2,2,2-trifluoroethyl 1-(3-methoxybenzoyl)indazole-3-carboxylate |
| SMILES | COc1cccc(C(=O)n2nc(C(=O)OCC(F)(F)F)c3ccccc32)c1 |
| InChI | InChI=1S/C18H13F3N2O4/c1-26-12-6-4-5-11(9-12)16(24)23-14-8-3-2-7-13(14)15(22-23)17(25)27-10-18(19,20)21/h2-9H,10H2,1H3 |
| InChIKey | BPNSXRJQOQZUBV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |