C24H30ClF3N6O — CID 56663171
N-[(1R,2R)-2-[[5-chloro-2-[(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 56663171) has the molecular formula C24H30ClF3N6O and a molecular weight of 510.99 g/mol. Its IUPAC name is N-[(1R,2R)-2-[[5-chloro-2-[(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2R)-2-[[5-chloro-2-[(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 56663171 |
| Molecular Formula | C24H30ClF3N6O |
| Molecular Weight | 510.99 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | N-[(1R,2R)-2-[[5-chloro-2-[(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | CCN1CCc2ccc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@H]4NC(=O)C(F)(F)F)n3)cc2CC1 |
| InChI | InChI=1S/C24H30ClF3N6O/c1-2-34-11-9-15-7-8-17(13-16(15)10-12-34)30-23-29-14-18(25)21(33-23)31-19-5-3-4-6-20(19)32-22(35)24(26,27)28/h7-8,13-14,19-20H,2-6,9-12H2,1H3,(H,32,35)(H2,29,30,31,33)/t19-,20-/m1/s1 |
| InChIKey | MATHWQFCWXKDBA-WOJBJXKFSA-N |
| XLogP | 4.70 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.99 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |