C25H32ClF3N6O2 — CID 56663172
N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 56663172) has the molecular formula C25H32ClF3N6O2 and a molecular weight of 541.02 g/mol. Its IUPAC name is N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 56663172 |
| Molecular Formula | C25H32ClF3N6O2 |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | COCCN1CCc2ccc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@H]4NC(=O)C(F)(F)F)n3)cc2CC1 |
| InChI | InChI=1S/C25H32ClF3N6O2/c1-37-13-12-35-10-8-16-6-7-18(14-17(16)9-11-35)31-24-30-15-19(26)22(34-24)32-20-4-2-3-5-21(20)33-23(36)25(27,28)29/h6-7,14-15,20-21H,2-5,8-13H2,1H3,(H,33,36)(H2,30,31,32,34)/t20-,21-/m1/s1 |
| InChIKey | CTOIWJDYNIQZEG-NHCUHLMSSA-N |
| XLogP | 4.32 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |