C23H33ClN6O — CID 56663173
4-N-[(1R,2R)-2-aminocyclohexyl]-5-chloro-2-N-[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]pyrimidine-2,4-diamine (PubChem CID 56663173) has the molecular formula C23H33ClN6O and a molecular weight of 445.01 g/mol. Its IUPAC name is 4-N-[(1R,2R)-2-aminocyclohexyl]-5-chloro-2-N-[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(1R,2R)-2-aminocyclohexyl]-5-chloro-2-N-[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 56663173 |
| Molecular Formula | C23H33ClN6O |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 4-N-[(1R,2R)-2-aminocyclohexyl]-5-chloro-2-N-[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]pyrimidine-2,4-diamine |
| SMILES | COCCN1CCc2ccc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@H]4N)n3)cc2CC1 |
| InChI | InChI=1S/C23H33ClN6O/c1-31-13-12-30-10-8-16-6-7-18(14-17(16)9-11-30)27-23-26-15-19(24)22(29-23)28-21-5-3-2-4-20(21)25/h6-7,14-15,20-21H,2-5,8-13,25H2,1H3,(H2,26,27,28,29)/t20-,21-/m1/s1 |
| InChIKey | BRCAAXPOGGBGLV-NHCUHLMSSA-N |
| XLogP | 3.60 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |