C25H25N5O3 — CID 56663207
3-[(6-benzoyl-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-N-(2-methoxyethyl)-4-methylbenzamide (PubChem CID 56663207) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 3-[(6-benzoyl-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-N-(2-methoxyethyl)-4-methylbenzamide.
| Compound Name | 3-[(6-benzoyl-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-N-(2-methoxyethyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 56663207 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 3-[(6-benzoyl-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-N-(2-methoxyethyl)-4-methylbenzamide |
| SMILES | COCCNC(=O)c1ccc(C)c(Nc2ncnn3cc(C(=O)c4ccccc4)c(C)c23)c1 |
| InChI | InChI=1S/C25H25N5O3/c1-16-9-10-19(25(32)26-11-12-33-3)13-21(16)29-24-22-17(2)20(14-30(22)28-15-27-24)23(31)18-7-5-4-6-8-18/h4-10,13-15H,11-12H2,1-3H3,(H,26,32)(H,27,28,29) |
| InChIKey | QVYXWTTUVCYNCD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|