C22H32N2O3 — CID 56663324
4-[(5R,6R,9S,13S)-7-benzyl-1-oxido-7-aza-1-azoniatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid (PubChem CID 56663324) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-benzyl-1-oxido-7-aza-1-azoniatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid.
| Compound Name | 4-[(5R,6R,9S,13S)-7-benzyl-1-oxido-7-aza-1-azoniatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
|---|---|
| PubChem CID | 56663324 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-benzyl-1-oxido-7-aza-1-azoniatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@@H]1[C@H]2CCC[N+]3([O-])CCC[C@@H](CN1Cc1ccccc1)[C@@H]23 |
| InChI | InChI=1S/C22H32N2O3/c25-21(26)12-4-11-20-19-10-6-14-24(27)13-5-9-18(22(19)24)16-23(20)15-17-7-2-1-3-8-17/h1-3,7-8,18-20,22H,4-6,9-16H2,(H,25,26)/t18-,19+,20+,22-,24?/m0/s1 |
| InChIKey | GSSHMZUWXVVKBL-RZQKWFAGSA-N |
| XLogP | 3.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|