C16H15N3 — CID 56663361
1,4-dibenzyltriazole (PubChem CID 56663361) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 1,4-dibenzyltriazole.
| Compound Name | 1,4-dibenzyltriazole |
|---|---|
| PubChem CID | 56663361 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1,4-dibenzyltriazole |
| SMILES | c1ccc(Cc2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C16H15N3/c1-3-7-14(8-4-1)11-16-13-19(18-17-16)12-15-9-5-2-6-10-15/h1-10,13H,11-12H2 |
| InChIKey | UQFYTTMJPYLAJY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |