About 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea
1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea (PubChem CID 56663547) has the molecular formula C21H18Br2N2O2
and a molecular weight of 490.20 g/mol. Its IUPAC name is 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea.
Molecular Properties
| Compound Name | 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea |
| PubChem CID | 56663547 |
| Molecular Formula | C21H18Br2N2O2 |
| Molecular Weight | 490.20 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea |
| SMILES | Cc1ccc(N(Cc2cc(Br)cc(Br)c2O)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18Br2N2O2/c1-14-7-9-18(10-8-14)25(21(27)24-17-5-3-2-4-6-17)13-15-11-16(22)12-19(23)20(15)26/h2-12,26H,13H2,1H3,(H,24,27) |
| InChIKey | FZXZJMKYNKNJQK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.20 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea?
The IUPAC name of 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea (CID 56663547) is 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea.
What is the SMILES notation for 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea?
The canonical SMILES for 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea is Cc1ccc(N(Cc2cc(Br)cc(Br)c2O)C(=O)Nc2ccccc2)cc1.
What is the InChIKey of 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea?
The InChIKey is FZXZJMKYNKNJQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18Br2N2O2/c1-14-7-9-18(10-8-14)25(21(27)24-17-5-3-2-4-6-17)13-15-11-16(22)12-19(23)20(15)26/h2-12,26H,13H2,1H3,(H,24,27).
What are the key properties of 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea?
1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea has a molecular weight of 490.20 g/mol, XLogP of 6.46, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-(4-methylphenyl)-3-phenylurea is sourced from PubChem (CID 56663547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).