C26H26N4O4S — CID 56663558
(6aR,9R)-9-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-N-phenyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-7-carboxamide (PubChem CID 56663558) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is (6aR,9R)-9-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-N-phenyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-7-carboxamide.
| Compound Name | (6aR,9R)-9-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-N-phenyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 56663558 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (6aR,9R)-9-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-N-phenyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-7-carboxamide |
| SMILES | O=C([C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C(=O)Nc2ccccc2)C1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C26H26N4O4S/c31-25(29-9-11-35(33,34)12-10-29)18-13-21-20-7-4-8-22-24(20)17(15-27-22)14-23(21)30(16-18)26(32)28-19-5-2-1-3-6-19/h1-8,13,15,18,23,27H,9-12,14,16H2,(H,28,32)/t18-,23-/m1/s1 |
| InChIKey | LFLPETLMAIHEHG-WZONZLPQSA-N |
| XLogP | 2.90 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |